quảng cáo kqxs full 2

TOPIC KHU CHĂN NUÔI K2N THÁNG 01/2020

Thảo luận trong 'CHĂN NUÔI XSMB' bắt đầu bởi Kubi247, 31/12/19.

Lượt xem: 180,233

Trạng thái chủ đề:
Tạm đóng.
  1. linhbom94

    linhbom94 Lính mới

    Tham gia:
    29/4/19
    Bài viết:
    113
    Được thích:
    175
    Điểm thành tích:
    43
    02 n1 chứ
     
  2. dothieugia91

    dothieugia91 Lucky Xổ Số

    Tham gia:
    31/10/17
    Bài viết:
    5,716
    Được thích:
    8,434
    Điểm thành tích:
    113
    Nghề nghiệp:
    Chuyên dàn đề 36-45s
    CHĂN NUÔI LOTTO CẶP K2N: T1/2020
    LẦN 1: CHĂN CẶP 34-94 K2N ( Từ 01 -> 02/01 ) Nhận 94 N1
    LẦN 2: CHĂN CẶP 68-86 K2N ( Từ 02 -> 03/01 ) Nhận 86 N1
    LẦN 3: CHĂN CẶP 27-81 K2N ( Từ 03 -> 04/01 ) Nhận X

    LẦN 4: CHĂN CẶP 23-75 K2N ( Từ 05 -> 06/01 ) Nhận 23 N2
    LẦN 5: CHĂN CẶP 27-72 K2N ( Từ 07 -> 08/01 ) Nhận 72 N1
    LẦN 6: CHĂN CẶP 56-86 K2N ( Từ 08 -> 09/01 ) Nhận 56-86 N1
    [B][B][B][B][B][B][B][B][B][B][B][B]LẦN 7: CHĂN CẶP 05-29 K2N ( Từ 09 -> 10/01 ) Nhận ...[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
     
    Ssssss29, linhbom94KwonJiyong88 Thích điều này.
  3. KwonJiyong88

    KwonJiyong88 Lính mới

    Tham gia:
    16/10/19
    Bài viết:
    164
    Được thích:
    279
    Điểm thành tích:
    63
    Chăn nuôi STL K2N tháng 01/2020

    Lần 1 : Chăn 67,76 từ 05-06/01 =} Tạch
    Lần 2 : Chăn 05,50 từ 07-08/01 =} nhận... 05** N2
    Lần 3 : Nuôi 68,86 từ 09-10/01 =} nhận...
    ( Cặp 050 và 787 K2N cũng đẹp ^^ )
     
    linhbom94 thích bài này.
  4. Lotto228

    Lotto228 Thành viên kiểm duyệt

    Tham gia:
    30/9/16
    Bài viết:
    801
    Được thích:
    1,187
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 1/2020:
    Lần 1: 93-98.Miss
    Lần 2: 94.99 từ 5–6. Nổ 94 ngày 1.
    Lần 3 696 từ 6–7. Nổ 69 ngày 1.
    Lần 4: 404 từ 7–8.Nổ 04x2 ngày 2.

    Lần 5: 636 từ 9–10...
     
    TOIVIEM, amphonglaoquaiLamskt Thích điều này.
  5. 0868

    0868 Thành viên kiểm duyệt

    Tham gia:
    29/10/19
    Bài viết:
    387
    Được thích:
    2,083
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 01 /2020


    Lần 1 : Chăn cặp 32 - 33 - K2N (Từ 01/01 -> 02/01 ) - Nhận 33 N1
    Lần 2 : Chăn cặp 59 - 95 - K2N (Từ 02/01 -> 03/01 ) - Miss
    Lần 3: Chăn cặp 25 - 52 - K2N (Từ 04/01 -> 05/01 ) - Miss
    Lần 4: Chăn cặp 68 - 52 - K2N (Từ 06/01 -> 07/01 ) - Nhận 52 N2
    Lần 5: Chăn cặp 68 - 86 - K2N (Từ 08/01 -> 09/01 ) - Nhận 86 N1

    Lần 6: Chăn cặp 68 - 01 - K2N (Từ 09/01 -> 10/01 ) -
     
    Lamskt thích bài này.
  6. iphatloc102

    iphatloc102 Thành viên kiểm duyệt

    Tham gia:
    31/10/19
    Bài viết:
    281
    Được thích:
    818
    Điểm thành tích:
    93
    Nghề nghiệp:
    Nghiên cứu số học
    Chăn nuôi STL K2N tháng 1/2020
    Lần 1: chăn 34-43 (01-2/01) nhận 34 n2
    Lần 2: chăn 21,23 (03-4/01) nhận 23 n1
    Lần 3: chăn 23,21 (04-5/01) nhận 21 n2
    Lần 4: chăn 91,96 (06-7/01) nhận miss
    Lần 5: chăn 08,65 (08-9/01) nhận 08 n1
    Lần 6: chăn 38,58 (09-10/1)
     
    milano00737TOIVIEM thích điều này.
  7. tuan100lit

    tuan100lit Lính mới

    Tham gia:
    30/10/19
    Bài viết:
    101
    Được thích:
    105
    Điểm thành tích:
    43
    CHĂN NUÔI LOTTO CẶP K2N T1/2020
    LẦN 1: CHĂN CẶP 53,35 (TỪ 1/1 -> 2/1) NHẬN 53 N1
    LẦN 2: CHĂN CẶP 47,74 (TỪ 2/1 -> 3/1) NHẬN MISS
    LẦN 3: CHĂN CẶP 15,51 (TỪ 4/1 -> 5/1) NHẬN 15 N1
    LẦN 3: CHĂN CẶP 22,72 (TỪ 5/1 -> 6/1) NHẬN 72 N2
    LẦN 4: CHĂN CẶP 29,92 (TỪ 7/1 -> 8/1) NHẬN 92 N2
    LẦN 5: CHĂN CẶP 19,91 (TỪ 9/1 -> 10/1) NHẬN
     
  8. SucSongMoi2

    SucSongMoi2 Điều hành viên

    Tham gia:
    19/8/18
    Bài viết:
    1,652
    Được thích:
    17,724
    Điểm thành tích:
    113
    CHĂN NUÔI LOTTO CẶP K2N 01.2020

    Lần 1 45,54 (02-03/01) nhận Miss
    Lần 2 46,64 (04-05/01) nhận 64** N2
    Lần 3 58,85 (06-07/01) nhận 85* N2
    Lần 4 39,93 (08-09/01) nhận 93* N1
    Lần 5 47,74 (09-10/01) nhận
     
    lottoonline, anhtudo7979, rocky2 thành viên khác Thích điều này.
  9. fantosy

    fantosy Thành viên kiểm duyệt

    Tham gia:
    14/2/13
    Bài viết:
    194
    Được thích:
    44
    Điểm thành tích:
    28
    Chăn nuôi lotto cặp K2N tháng 01-2020
    + Lần 1: chăn 13-31 (từ 01-02/01)...Nhận 31N2
    + Lần 2: Chăn 23-32 (từ 03-04/01)...Nhận 23N1
    + Lần 3: Chăn 22-33 (từ 04-05/01)...Missss
    + Lần 4 : Chăn 85-58 (từ 06-07/01)..Nhận 85N2
    +Lần 5: Chăn 68-86 (tư 08-09/01)..Nhận 86N1
    + Lần 6: Chăn 62-87 (từ 09-10/01)....
     
  10. Yasgnol

    Yasgnol Thành viên kiểm duyệt

    Tham gia:
    18/8/18
    Bài viết:
    199
    Được thích:
    834
    Điểm thành tích:
    93
    Chăn nuôi lotto cặp K2N tháng 01-2020
    Lần 1: 80,90 (9-10/01) nhận...
     
    linhbom94, Kubi247TOIVIEM Thích điều này.
  11. Kubi247

    Kubi247 Điều hành viên Thành viên BQT

    Tham gia:
    28/2/17
    Bài viết:
    5,414
    Được thích:
    7,415
    Điểm thành tích:
    113
    Nghề nghiệp:
    tự do
    BẢNG THỐNG KÊ CHĂN NUÔI K2N THÁNG 01/2020
    [​IMG]
     
  12. BinHN

    BinHN Thành viên kiểm duyệt

    Tham gia:
    1/11/10
    Bài viết:
    1,782
    Được thích:
    1,913
    Điểm thành tích:
    113
    CHĂN NUÔI LOTTO CẶP K2N: T1/2020
    Lần 1: Chăn cặp 18,81 K2N (Từ 01>02/01) Nhận 81 Ngày 1
    Lần 2: Chăn cặp 02,20 K2N (Từ 02>03/01) Nhận 02 Ngày 2
    Lần 3: Chăn cặp 29,92 K2N (Từ 04>05/01) Nhận 29 Ngày 2
    Sorry Mod 06/01 Quên post mất ăn 06,60
    Lần 4: Chăn cặp 18,81 K2N (Từ 07>08/01) Miss
    Lần 5: Chăn cặp 09,10 K2N (Từ 09>10/01)
     
    TT6789 thích bài này.
  13. phtrdeloto

    phtrdeloto Lucky Xổ Số

    Tham gia:
    3/11/11
    Bài viết:
    14,578
    Được thích:
    6,266
    Điểm thành tích:
    113
    SONG THỦ LOTO KHUNG 2 NGÀY THÁNG 01/2020

    - Lần 01 : STL 27,72 k2 (từ 02/01 - 03/01)=>MISS
    - Lần 02 : STL 27,72 k2 (từ 04/01 - 05/01)=>MISS
    - Lần 03 : STL 38,83 k2 (từ 06/01 - 07/01)=>nhận 38 N1 (06/01)
    - Lần 04 : STL 19,91 k2 (từ 07/01 - 08/01)=>nhận 91 N2 (08/01)
    [/quote]

    - Lần 05 : STL 21,12 k2 (từ 09/01 - 10/01)
     
  14. quedau1981

    quedau1981 Điều hành viên

    Tham gia:
    7/6/11
    Bài viết:
    8,905
    Được thích:
    101,401
    Điểm thành tích:
    113
    Nghề nghiệp:
    Thất nghiệp
    Chăn nuôi stl k2n tháng 1/2020
    Lần 1: chăn 26,76 từ 01/01-2/01 nhận 76**N2
    Lần 2: chăn 26,76 từ 03/01-4/01 xịt
    Lần 3: chăn 84,76 từ 05/01-6/01 nhận 84**N2
    Lần 4: chăn 84,76 từ 07/01-8/01 xịt
    Lần 5: chăn 84,01 từ 09/01-10/01
     
    mimylinhbom94 thích điều này.
  15. Heovang83

    Heovang83 Thành viên kiểm duyệt

    Tham gia:
    21/2/19
    Bài viết:
    1,038
    Được thích:
    3,155
    Điểm thành tích:
    113
    Chăn nuôi lô tô cặp K2N tháng 01/2020
    Lần 1: chăn cặp 484 từ (01÷02/01) nhận 84 n1
    Lần 2: chăn cặp 484từ (02÷03/01) nhận.48n1
    Lần 3: chăn cặp 484từ (03÷04/01) nhận 84 n1
    Lần 4: chăn cặp 484 từ (04÷05/01) nhận 84n1
    Lần 5: chăn cặp 484 từ (05÷06/01) nhận 84**n2
    Lần 6: chăn cặp 484 từ (07÷08/01) nhận xịt
    Lần 7: chăn cặp 898 từ (09÷10/01) nhận
     
    Lamskt thích bài này.
  16. thiendangduy

    thiendangduy Lucky Xổ Số

    Tham gia:
    6/7/13
    Bài viết:
    1,679
    Được thích:
    4,174
    Điểm thành tích:
    113
    Nghề nghiệp:
    Design
    CHĂN NUÔI STL K2N THÁNG 01/2020

    LẦN 1: 47 74 (01/01-> 02/01) nhận xịt
    LẦN 2: 02 20 (03/01-> 04/01) nhận 02 N1
    LẦN 3: 59 95 (04/01-> 05/01) nhận 59 95 N2
    LẦN 4: 24 42 (06/01-> 07/01) nhận 42 N2
    LẦN 5: 68 86 (08/01-> 09/01) nhận 86 N1
    LẦN 6: 39 59 (09/01-> 10/01) nhận...

    CHÚC ACE MAY MẮN.
     
  17. Rauria

    Rauria Lính mới

    Tham gia:
    30/6/19
    Bài viết:
    125
    Được thích:
    131
    Điểm thành tích:
    43
    CHĂN NUÔI LOTTO CẶP: T1/2020
    LẦN 1: CHĂN CẶP 58-85 K2N(TỪ 01 -> 02/01) nhan 58 ngay 1
    LẦN 2: CHĂN CẶP 59-95 K2N(TỪ 02 -> 03/01) xit lan 1
    LẦN 3: CHĂN CẶP 08-80 K2N(TỪ 05 -> 06/01) nhan 08 ngay 1
    LẦN 4: CHĂN CẶP 57-75 K2N(TỪ 06 -> 07/01) xit lan 2
    LẦN 5: CHĂN CẶP 58-85 K2N(TỪ 09 -> 10/01)
     
  18. sangpro0108

    sangpro0108 Thành viên kiểm duyệt

    Tham gia:
    11/5/11
    Bài viết:
    183
    Được thích:
    307
    Điểm thành tích:
    63
    Nghề nghiệp:
    chan nuoi lo
    L1: 79.80(2-3) nhận 79 N2
    L2: 78.79 (6-7) nhận 78 N2
    L3: 393 (8-9) Nhận 93 N1
    L4: 585 (9-10)
     
    anhtudo7979 thích bài này.
  19. vklkinhthe

    vklkinhthe Thành viên kiểm duyệt

    Tham gia:
    7/5/12
    Bài viết:
    64
    Được thích:
    22
    Điểm thành tích:
    8
    Nghề nghiệp:
    Mobile
    LẦN 1: CHĂN CẶP 67.76 K2N(TỪ 01 -> 02/01). Nhận 67 N1
    LẦN 2: CHĂN CẶP 57.75 K2N(TỪ 02 -> 03/01). Nhận 75 N2
    LẦN 3: CHĂN CẶP 29.92 K2N(TỪ 04 -> 05/01). Nhận 29 N2
    LẦN 4: CHĂN CẶP 76.67 K2N(TỪ 06 -> 07/01). Nhận 67 N2
    LẦN 5: CHĂN CẶP 48.84 K2N(TỪ 09 -> 10/01). Nhận .......
     
  20. thangsdt

    thangsdt Lucky Xổ Số

    Tham gia:
    4/5/12
    Bài viết:
    462
    Được thích:
    1,319
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 1/2020
    LẦN 1: 12-21 (từ 2-3/1) nhận 12 n1
    LẦN 2: 33-88 (từ 3-4/1) nhận 33 n1
    LẦN 3: 89-98 (từ 4-5/1) nhận 98 n1
    LẦN 4: 22-77 (từ 5-6/1) nhận 77 n2
    LẦN 5: 01-11 (từ 7-8/1) nhận 11 n1
    LẦN 6: 44-45 (từ 8-9/1) nhận 45 n1
    LẦN 7: 27-77 (từ 9-10/1) nhận 27 27 n1
    LẦN 8: 85-87 (từ 10-11/1)
     
Trạng thái chủ đề:
Tạm đóng.

Cộng đồng Ketqua.net