quảng cáo kqxs full 2


Thảo luận trong 'KHU CHĂN NUÔI' bắt đầu bởi Kubi247, 30/11/19.

Lượt xem: 146,271

Trạng thái chủ đề:
Tạm đóng.
  1. dothieugia91

    dothieugia91 Lucky Xổ Số

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Nghề nghiệp:
    Chuyên dàn đề 36-45s
    Chăn nuôi loto cặp K3N tháng 12/2019:
    Lần 1: Chăn cặp 48-84 (Từ 01- 03/12) Nhận 48 N1

    Lần 2: Chăn cặp 58-85 (Từ 02- 04/12) Nhận 85 N1
    Lần 3: Chăn cặp 38-82 (Từ 03- 05/12) Nhận 82 N2
    Lần 4: Chăn cặp 47-92 (Từ 05- 07/12) Nhận 92 N1
    Lần 5: Chăn cặp 79-97 (Từ 06- 08/12) Nhận Xịt
    Lần 6: Chăn cặp 46-64 (Từ 09- 11/12) Nhận 64 N2
    Lần 7: Chăn cặp 35-88 (Từ 11- 13/12) Nhận 35 N2
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]Lần 8: Chăn cặp 58-85 (Từ 13- 15/12) Nhận ...[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
    linhbom94ordy thích điều này.
  2. HayDoiDay123

    HayDoiDay123 Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Chăn nuôi loto cặp K3N tháng 12/2019:
    Lần 1:
    Chăn 26,27 (Từ 01- 03/12) Nhận 26,27 N1
    Lần 2: Chăn 36,37 (Từ 02- 04/12) Nhận 37** N2
    Lần 3: Chăn 73,74 (Từ 04- 06/12) Nhận 73** N1
    Lần 4: Chăn 86,87 (Từ 05- 07/12) Nhận 87 N1
    Lần 5: Chăn 82,83 (Từ 06- 08/12) Nhận 82 N2
    Lần 6: Chăn 53,54 (Từ 08- 10/12) Nhận 54 N1
    Lần 7: Chăn 31,32 (Từ 09- 11/12) Nhận 31 N1
    Lần 8: Chăn 67,68 (Từ 10- 12/12) Nhận 68 N3
    Lần 9: Chăn 13,14 (Từ 13- 15/13)
    Lovely81, vgdoanh82, TOIVIEM and 1 người khác Thích điều này.
  3. Banthovangem88

    Banthovangem88 Lính mới

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    LẦN 1:CHĂN CẶP 34-43(TỪ 13-15/12)
  4. cuongls1102

    cuongls1102 Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Nghề nghiệp:
    Trà Đá K+
    LẦN 1: CHĂN CẶP 69,96 K3N (01/12->03/12)
    => nhận 69*.
    LẦN 2: CHĂN CẶP 78,87 K3N (02/12->04/12)
    => nhận 78*.
    LẦN 3: CHĂN CẶP 42,24 K3N (03/12->05/12)
    => nhận 42***.
    LẦN 4: CHĂN CẶP 68,86 K3N (06/12->08/12)
    => nhận 68**.
    LẦN 5: CHĂN CẶP 03,30 K3N (08/12->10/12)
    => miss
    LẦN 6: CHĂN CẶP 86,87 K3N (13/12->15/12)
    ordy thích bài này.
  5. hoangkako

    hoangkako Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    linhbom94ordy thích điều này.
  6. sobt89

    sobt89 Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Lần 1: chăn cặp 37,73 K3N (từ 01/12 ->03/12) Nhận 37** ngày 3
    Lần 2: chăn cặp 78,87 K3N (từ 04/12->06/12) Nhận 78,87 ngày 2
    Lần 3: chăn cặp 44,99 K3N (từ 06/12->08/12) nhận 99** ngày 2
    Lần 4: chăn cặp 19,91 K3N (từ 08/12->10/12) nhận 19 ngày 1
    Lần 5: chăn cặp 01,10 K3N (từ 09/12->11/12) nhận 01 ngày 1
    Lần 6: chăn cặp 89,98 K3N (từ 10/12-12/12) nhận xịt L1
    Lần 7: chăn cặp 89,98 K3N (từ 13/12-15/12) nhận
    ordy thích bài này.
  7. ancaca88

    ancaca88 Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    CHĂN NUÔI K3N THÁNG 12/2019
    Lần 1: chăn 37,73 (từ 2-4/12) Nhận 37** N2
    Lần 2: chăn 48,84 (từ 4-6/12) Nhận 84 N2
    Lần 3: chăn 69,96 (từ 6-8/12) Nhận 69,96 N3
    Lần 4: chăn 02,20 (từ 9-11/12)Nhận 20 N3
    Ngày 12/12 nghỉ
    Lần 5: chăn 36,63 (từ 13-15/12) Nhận...
    TOIVIEMordy thích điều này.
  8. xin1conLo

    xin1conLo Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Chăn nuôi loto cặp K3N tháng 12/2019:
    Lần 1: Chăn 23,32 từ 1-3/12 nhận 23,32** N1
    Lần 2: chăn 57,75 từ 2-4/12 nhận 57 N1
    Lần 3: chăn 34,43 từ 3-5/12 nhận 43 N3
    Lần 4: chăn 57,75 từ 6-8/12 nhận 57,75 N1
    Lần 5: chăn 57,75 từ 7-9/12 nhận 57 N3
    Lần 6: chăn 07,70 từ 10-12/12 nhận 07 N2
    Lần 7: chăn 68,86 từ 12-14/12 nhận 68 N1
    Lần 8: chăn 42,43 từ 13-15/12
    TOIVIEMordy thích điều này.
  9. Richarddoan

    Richarddoan Lính mới

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    CHĂN NUÔI K3N THÁNG 12/2019
    Lần 1: chăn 23,32 (từ 1-3/12) nhận 23-32*2 N1
    Lần 2: chăn 35,53 (từ 2-4/12) nhận 35 N3
    Lần 3: chăn 17,71 ( từ 5-7/12) nhận 17 N2
    Lần 4: chăn 18,81 (từ 7-9/12) Xịt
    Lần 5: chăn 18,81 ( từ 10-12/12) nhận 81 N1
    Lần 6: chăn 04,40 (từ 11-13/12) nhận 04,40 N2
    Lần 7: chăn 00,55 (từ 13-15/12) nhận ...
    ordy thích bài này.
  10. tuyenduong

    tuyenduong Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Nghề nghiệp:
    Ăn bám,Lang Thang và Vô gia cư
    LẦN 1: CHĂN CẶP 95,59 K3N(TỪ 01/12-> 03/12)

    Nhận 59*N1
    Lần 2: Chăn cặp 31,32 K3N(Từ 02/12->04/12)
    Nhận 31*N2
    Lần 3: Chăn cặp 92,18 K3N (Từ 04/12->06/12)
    Nhận 92*N1
    Lần 4: Chăn cặp 48,84 K3N (Từ 05/12->07/12)
    Nhận 84*N1
    Lần 5: Chăn cặp 21,12 K3N (Từ 06/12->08/12)
    Nhận 21*N1
    Lần 6: Chăn cặp 80,08 K3N (Từ 07/12->09/12)
    Nhận 08*N2
    Lần 7: Chăn cặp 52,25 K3N (Từ 10/12->12/12)
    Lần 8: Chăn cặp 25,92 K3N (Từ 13/12->15/12)
    Vietlotordy thích điều này.
  11. BaMinhBeo

    BaMinhBeo Lính mới

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Chăn nuôi lô cặp K3N tháng 12
    Lần 1: Chăn cặp 10,61 (01 -03/12).Nhận 61*** ngày 1
    Lần 2: Chăn cặp 11,31 (02- 04/12).Nhận 11,31 ngày 2

    Lần 3: chăn cặp 51,52 (06-08/12).Nhận 51 ngày 1
    Lần 4: Chăn cặp 23,32 (07-09/12).Nhận 23 ngày 3
    Lần 5: chăn cặp 38,34 (11-13/12).Nhận 38 ngày 1
    Lần 6: chăn cặp 27,39 (12-14/12).Nhận 27,39 ngày 1

    Lần 7: chăn cặp 16,15 ( 13-15/12)
    ordyLovely81 thích điều này.
  12. zjpzop

    zjpzop Lucky Xổ Số

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    LẦN 1: CHĂN CẶP 95,59 K3N(TỪ 01/12-> 03/12) Nhận 59 ngày 1

    LẦN 2: CHĂN CẶP 11,66 K3N(TỪ 02/12-> 04/12) Nhận 11 ngày 2
    LẦN 3: CHĂN CẶP 15,51 K3N(TỪ 04/12-> 06/12) Nhận 51 ngày 1
    LẦN 3: CHĂN CẶP 03,30 K3N(TỪ 05/12-> 07/12) Nhận 30 ngày 1
    LẦN 4: CHĂN CẶP 67,76 K3N(TỪ 06/12-> 08/12) Nhận 76 ngày 1
    LẦN 5: CHĂN CẶP 68,86 K3N(TỪ 07/12-> 09/12) Nhận 68** ngày 1
    LẦN 6: CHĂN CẶP 39,93 K3N(TỪ 08/12-> 10/12) Nhận 39** ngày 1
    LẦN 7: CHĂN CẶP 08,80 K3N(TỪ 09/12-> 11/12) Nhận 08 ngày 1
    LẦN 8: CHĂN CẶP 07,17 K3N(TỪ 10/12-> 12/12) Nhận 07 ngày 2
    LẦN 9: CHĂN CẶP 04,40 K3N(TỪ 12/12-> 14/12) Nhận 04,40 ngày 1
    Lần 10: CHĂN CẶP 19,41 K3N(TỪ 13/12->15/12)
    anhtudo7979, choisogiaitri, ordy2 thành viên khác Thích điều này.
  13. Xin1conDE_DeEmCapBen

    Xin1conDE_DeEmCapBen Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Chăn nuôi lotto cặp K3N tháng 12/2019:
    Lần 01: Chăn 78,87 (từ 01-03) nhận 78*, 87* n1
    Lần 02: Chăn 78,87 (từ 02-04) nhận 78* n1
    Lần 03: Chăn 78,87 (từ 03-05) nhận 78* n1
    Lần 04: Chăn 79,97 (từ 04-06) Miss lần 1
    Lần 05: Chăn 79,97 (từ 07-09) Miss lần 2
    Lần 06: Chăn 83,84 (từ 10-12) Miss lần 3
    Xin phép nghỉ chăn, đỡ loãng số :D
    ancaca88, ordyTOIVIEM Thích điều này.
  14. lotobe

    lotobe Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    chưa từng thấy bao giờ miss liền 3 khung của bác.
    TOIVIEMordy thích điều này.
  15. Kubi247

    Kubi247 Điều hành viên Thành viên BQT

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Nghề nghiệp:
    tự do

    lotobe, xin1conLoThosanloto89 Thích điều này.
  16. HoangBaoQC

    HoangBaoQC Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    CHĂN STL K3N THÁNG 12 /2019
    Lần 1: 87-78 từ 1-3/12 nhận 78*87* n1
    Lần 2: 86-68 từ 2-4/12 nhận 68** n2
    04/12 nghỉ
    Lần 3: 11-66 từ 5-7/12 nhận 66* n2
    Lần 4: 79-97 từ 7-9/12 nhận miss
    Lần 5: 48-84 từ 10-12/12 nhận 48 n1
    Lần 6: 15-51 từ 11-13/12 nhận 15 n1
    Lần 7: 85-58 từ 12-14/12 nhận 58 n1
    Lần 8: 46-64 từ 13-15/12 nhận
    ordy thích bài này.
  17. Hà lương

    Hà lương Lính mới

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Chăn nuôi loto cặp k3n tháng 12/2019
    Lần1:393(từ1-3/12) Nhận 39,93 ngày 3
    Lần2:393(từ4-6/12) Nhận 39,93 ngày 1
    Lần3:393(từ5-7/12) Nhận 93 ngày 1
    Lần4:393(từ6-8/12) Nhận 39,39 ngày 3
    Lần5:393(từ9-11/12) Nhận 93 ngày 1
    Lần6:393(từ10-12/12) Nhận 39 ngày 3
    ordyThosanloto89 thích điều này.
  18. Lucky36868

    Lucky36868 Lính mới

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Chết sặc tiết.
  19. datviet1na

    datviet1na Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    Nghề nghiệp:
    Bơ vơ
    CHĂN NUÔI K3N THÁNG 12/2019
    Lần 1: chăn 47,74 (từ 2-4/12)
    Lần 2: Chăn 59,78 K3N (07-10/12). Nhận 78* N1
    Lần 3: Chăn 59,86 K3N (08-11/12). Nhận 86* N1
    Lần 4: Chăn 59,84 K3N (09-12/12). Nhận 59* N1
    Lần 5: Chăn 24,42 K3N (10-12/12). Nhận 24* N1
    Lần 6: Chăn 27,72 K3N (11-13/12). Nhận 27**N2
    Lần 7: Chăn 29,92 K3N (13-15/12).
    ordyTOIVIEM thích điều này.
  20. bwin

    bwin Thành viên kiểm duyệt

    Tham gia:
    Bài viết:
    Được thích:
    Điểm thành tích:
    LẦN 1: CHĂN CẶP 59,95 K3N(TỪ 01/12 -> 03/12).nhận 59 N1

    LẦN 2: CHĂN CẶP 95,96 K3N(TỪ 02/12 -> 04/12).nhận 96 N1

    LẦN 3: CHĂN CẶP 59,95 K3N(TỪ 03/12 -> 05/12).nhận 95 N1
    LẦN 4: CHĂN CẶP 58,85 K3N(TỪ 04/12 -> 06/12). Xịt
    LẦN 5: CHĂN CẶP 16,61 K3N(TỪ 07/12 -> 09/12) Nhận 16**,61 N1
    LẦN 6: CHĂN CẶP 34,43 K3N(TỪ 08/12 -> 10/12). Xịt
    Lần 7: Chăn cặp 78,88 K3N(từ 11/12 -> 12/12). Nhận 78**

    Lần 8: Chăn cặp 92,93 K3N(Từ 12/12 -> 14/12). Nhận 92,93** N2
    Lần 9: Chăn cặp 09,90 K3N(Từ 14/12 -> 16/12)
    ordy thích bài này.
Trạng thái chủ đề:
Tạm đóng.

Cộng đồng Ketqua.net