quảng cáo kqxs full 2
quảng cáo kqxs full 2

TOPIC KHU CHĂN NUÔI K3N THÁNG 12/2019

Thảo luận trong 'KHU CHĂN NUÔI' bắt đầu bởi Kubi247, 30/11/19.

Lượt xem: 149,021

Trạng thái chủ đề:
Tạm đóng.
  1. locphatvn68

    locphatvn68 Lính mới

    Tham gia:
    29/4/14
    Bài viết:
    307
    Được thích:
    813
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP K3N:
    LẦN 01: CHĂN CẶP 70,07 K3N(TỪ 02/12 -> 04/12). NGÀY 02/12 NHẬN 07*
    LẦN 02: CHĂN CẶP 84,48 K3N(TỪ 03/12 -> 05/12). NGÀY 05/12 NHẬN 84*.
    LẦN 03: CHĂN CẶP 36,63 K3N(TỪ 06/12 -> 08/12). NGÀY 07/12 NHẬN 36*.
    LẦN 04: CHĂN CẶP 68, 86 K3N(TỪ 08/12 -> 10/12). NGÀY 08/12 NHẬN 86*.
    LẦN 05: CHĂN CẶP 19,91 K3N(TỪ 09/12 -> 11/12). NGÀY 10/12 NHẬN 19*.
    LẦN 06: CHĂN CẶP 56,65 K3N(TỪ 11/12 -> 13/12).
     
    You Are All My Life, ordyTOIVIEM Thích điều này.
  2. Richarddoan

    Richarddoan Lính mới

    Tham gia:
    7/5/19
    Bài viết:
    101
    Được thích:
    177
    Điểm thành tích:
    43
    CHĂN NUÔI K3N THÁNG 12/2019
    Lần 1: chăn 23,32 (từ 1-3/12) nhận 23-32*2 N1
    Lần 2: chăn 35,53 (từ 2-4/12) nhận 35 N3
    Lần 3: chăn 17,71 ( từ 5-7/12) nhận 17 N2
    Lần 4: chăn 18,81 (từ 7-9/12) Xịt
    Lần 5: chăn 18,81 ( từ 10-12/12) nhận 81 N1
    Lần 6: chăn 04,40 (từ 11-13/12) nhận ...
     
    ordy thích bài này.
  3. lodenambac

    lodenambac Thành viên kiểm duyệt

    Tham gia:
    31/3/19
    Bài viết:
    1,664
    Được thích:
    2,746
    Điểm thành tích:
    113
    Nghề nghiệp:
    Phụ Hồ
    CHĂN NUÔI LOTO CẶP K3N THÁNG 12.2019
    LẦN 1: CHĂN CẶP 79-97 K3N(TỪ 02/12-> 04/12)- Nhận 97** N1
    LẦN 2: CHĂN CẶP 79-71 K3N(TỪ 03/12-> 05/12) -Nhận 79**N1
    LẦN 3: CHĂN CẶP 26-71 K3N(TỪ 04/12-> 06/12) - Nhận 26** N3
    LẦN 4: CHĂN CẶP 18-81 K3N(TỪ 07/12-> 09/12) -Xịt lần 1
    LẦN 5: CHĂN CẶP 81-18 K3N(TỪ 10/12-> 12/12)- Nhận 81* N1
    LẦN 6: CHĂN CẶP 88-18 K3N(TỪ 11/12-> 13/12)
     
    ordyTOIVIEM thích điều này.
  4. pongour3758

    pongour3758 Thành viên kiểm duyệt

    Tham gia:
    3/8/19
    Bài viết:
    216
    Được thích:
    894
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP K3N THÁNG 12/2019
    Lần 1: Cặp 89 98 (Từ 01-03/12) Nhận 89 98 N1.
    Lần 2: Cặp 97 79 (Từ 02-04/12) Nhận 97** N1.
    Lần 3: Cặp 05 06 (Từ 03-05/12) Nhận 06** N1.
    Lần 4: Cặp 24 42 (Từ 04-06/12) Nhận 42*** N2.
    Lần 5: Cặp 17 71 (Từ 06-08/12) Nhận 17 N1.
    Lần 6: Cặp 76 77 (Từ 07-09/12) Nhận 76 77 N2.
    Lần 7: Cặp 31 32 (Từ 09-11/12) Nhận 31 N1.
    Lần 8: Nghỉ
    Lần 9: Cặp 42 43 (Từ 11-13/12) Nhận...?
     
    choisogiaitri, ordyTOIVIEM Thích điều này.
  5. HoangBaoQC

    HoangBaoQC Thành viên kiểm duyệt

    Tham gia:
    4/5/18
    Bài viết:
    310
    Được thích:
    667
    Điểm thành tích:
    93
    CHĂN STL K3N THÁNG 12 /2019
    Lần 1: 87-78 từ 1-3/12 nhận 78*87* n1
    Lần 2: 86-68 từ 2-4/12 nhận 68** n2
    04/12 nghỉ
    Lần 3: 11-66 từ 5-7/12 nhận 66* n2
    Lần 4: 79-97 từ 7-9/12 nhận miss
    Lần 5: 48-84 từ 10-12/12 nhận 48 n1
    Lần 6: 15-51 từ 11-13/12 nhận


    Admin thống kê sai cặp 11,66 rồi kìa
     
    ordyKubi247 thích điều này.
  6. Kubi247

    Kubi247 Điều hành viên Thành viên BQT

    Tham gia:
    28/2/17
    Bài viết:
    2,922
    Được thích:
    2,636
    Điểm thành tích:
    113
    Nghề nghiệp:
    tự do
    BẢNG THỐNG KÊ CHĂN NUÔI K3N THANG 12/2019
    THÁNG 11 BẠN @lotobe NHẤT THÁNG K3N ĐC THƯỞNG 1 THẺ ĐT 100K, BẠN TẶNG LẠI CHO 4RUM VÀ SẼ TẶNG CHO BẠN NÀO NHẤT THÁNG 12 K3N NHÉ.

    [​IMG]
     
  7. Lotto228

    Lotto228 Thành viên kiểm duyệt

    Tham gia:
    30/9/16
    Bài viết:
    666
    Được thích:
    977
    Điểm thành tích:
    93
    [​IMG]
    Lotto228Thành viên kiểm duyệt
    CHĂN NUÔI K3N THÁNG 12/2019:
    Lần 1: 808 từ 1–3. Nổ 808.80 ngày 1.
    Lần 2: 101 từ 2–4. Nổ 01 ngày 1.
    Lần 3: 585 từ 3–5.;a36
    Lần 4: 191 từ 6–8. Nổ 19 ngày 3.
    Lần 5: 575 từ 9–11. Nổ 57 ngày 1.

    Lần 6: 848 từ 10–12. Nổ 48 ngày 1.
    Lần 7: 070 từ 11–13...
     
    choisogiaitriordy thích điều này.
  8. billmulti

    billmulti Lính mới

    Tham gia:
    10/9/17
    Bài viết:
    143
    Được thích:
    128
    Điểm thành tích:
    43
    CHĂN NUÔI K3N THÁNG 12/2019

    L1: LoTo 55-21 (01-03) nhận 21*n1
    L2: LoTo 55-78 (02-04) nhận 78*n1
    L3: LoTo 94-93 (03-05) nhận 93*n1
    L4: LoTo 10-91 (05-07) nhận Miss
    L5: LoTo 39-19 (08-10) nhận 39**19*n1
    L6: LoTo 49-94 (09-11) nhận 94*n1
    L7: LoTo 09-90 (10-12) nhận 09*n1
    L8: LoTo 19-91 (11-13) nhận
     
    ordyKetamthuong6789 thích điều này.
  9. xedaptongtoc

    xedaptongtoc Thành viên kiểm duyệt

    Tham gia:
    28/6/17
    Bài viết:
    525
    Được thích:
    975
    Điểm thành tích:
    93
    Nghề nghiệp:
    thầy bói
    Lần 1: Chăn 40, 41 (Từ 01- 03/12) Nhận 41 N2
    Lần 2: Chăn 09, 10 (Từ 03- 05/12) Nhận 09 N3
    Lần 3: Chăn 63, 64 (Từ 06- 08/12) Nhận 64 N1
    Lần 4: Chăn 15, 16 (Từ 07- 09/12) Nhận 16**N1
    Lần 5: Chăn 22, 23 ( tu 08- 10/12) Nhận 22, 23 N2
    Lần 6: Chăn 66, 65 ( tu 10- 12/12) Nhận 66 N1
    Lần 7: Chăn 18, 17 ( tu 11- 13/12) Nhận .....
     
    ordy, Annhientutai, thangs and 1 người khác Thích điều này.
  10. datviet1na

    datviet1na Thành viên kiểm duyệt

    Tham gia:
    8/2/11
    Bài viết:
    1,641
    Được thích:
    1,390
    Điểm thành tích:
    113
    Nghề nghiệp:
    Bơ vơ
    CHĂN NUÔI K3N THÁNG 12/2019
    Lần 1: chăn 47,74 (từ 2-4/12)
    Nghỉ
    Lần 2: Chăn 59,78 K3N (07-10/12). Nhận 78* N1
    Lần 3: Chăn 59,86 K3N (08-11/12). Nhận 86* N1
    Lần 4: Chăn 59,84 K3N (09-12/12). Nhận 59* N1
    Lần 5: Chăn 24,42 K3N (10-12/12). Nhận 24* N1
    Lần 6: Chăn 27,72 K3N (11-13/12).
     
    ordy thích bài này.
  11. bwin

    bwin Thành viên kiểm duyệt

    Tham gia:
    29/10/11
    Bài viết:
    207
    Được thích:
    878
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP THÁNG 12/2019 :
    LẦN 1: CHĂN CẶP 59,95 K3N(TỪ 01/12 -> 03/12).nhận 59 N1

    LẦN 2: CHĂN CẶP 95,96 K3N(TỪ 02/12 -> 04/12).nhận 96 N1

    LẦN 3: CHĂN CẶP 59,95 K3N(TỪ 03/12 -> 05/12).nhận 95 N1
    LẦN 4: CHĂN CẶP 58,85 K3N(TỪ 04/12 -> 06/12). Xịt
    LẦN 5: CHĂN CẶP 16,61 K3N(TỪ 07/12 -> 09/12) Nhận 16**,61 N1
    LẦN 6: CHĂN CẶP 34,43 K3N(TỪ 08/12 -> 10/12). Xịt
    Lần 7: Chăn cặp 78,88 K3N(từ 10/12 -> 12/12)
     
    ordyChuoiLuoc thích điều này.
  12. pongour3758

    pongour3758 Thành viên kiểm duyệt

    Tham gia:
    3/8/19
    Bài viết:
    216
    Được thích:
    894
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP K3N THÁNG 12/2019
    Lần 1: Cặp 89 98 (Từ 01-03/12) Nhận 89 98 N1.
    Lần 2: Cặp 97 79 (Từ 02-04/12) Nhận 97** N1.
    Lần 3: Cặp 05 06 (Từ 03-05/12) Nhận 06** N1.
    Lần 4: Cặp 24 42 (Từ 04-06/12) Nhận 42*** N2.
    Lần 5: Cặp 17 71 (Từ 06-08/12) Nhận 17 N1.
    Lần 6: Cặp 76 77 (Từ 07-09/12) Nhận 76 77 N2.
    Lần 7: Cặp 31 32 (Từ 09-11/12) Nhận 31 N1.
    Lần 8: Nghỉ
    Lần 9: Cặp 42 43 (Từ 11-13/12) Nhận 42 N1.
    Lần 10: Cặp 89 98 (Từ 12-14/12) Nhận...?
     
    ordy, thichthanhdong, TOIVIEM and 1 người khác Thích điều này.
  13. lodenambac

    lodenambac Thành viên kiểm duyệt

    Tham gia:
    31/3/19
    Bài viết:
    1,664
    Được thích:
    2,746
    Điểm thành tích:
    113
    Nghề nghiệp:
    Phụ Hồ
    CHĂN NUÔI LOTO CẶP K3N THÁNG 12.2019
    LẦN 1: CHĂN CẶP 79-97 K3N(TỪ 02/12-> 04/12)- Nhận 97** N1
    LẦN 2: CHĂN CẶP 79-71 K3N(TỪ 03/12-> 05/12) -Nhận 79**N1
    LẦN 3: CHĂN CẶP 26-71 K3N(TỪ 04/12-> 06/12) - Nhận 26** N3
    LẦN 4: CHĂN CẶP 18-81 K3N(TỪ 07/12-> 09/12) -Xịt lần 1
    LẦN 5: CHĂN CẶP 81-18 K3N(TỪ 10/12-> 12/12)- Nhận 81* N1
    LẦN 6: CHĂN CẶP 88-18 K3N(TỪ 11/12-> 13/12) - Nhân 18*N1
    LẦN 7: CHĂN CẶP 17-71 K3N(TỪ 12/12-> 14/12)
     
    ordyLovely81 thích điều này.
  14. minhquang2015

    minhquang2015 Lucky Xổ Số

    Tham gia:
    2/3/15
    Bài viết:
    14,396
    Được thích:
    8,327
    Điểm thành tích:
    113
    Nghề nghiệp:
    BS
    CHĂN NUÔI LOTTO CẶP K3N THÁNG 12 /2019
    LẦN 1 : CHĂN CẶP 01,13 K3N (TỪ 01/12 -> 03/12 ) NHẬN 01* 13** N 2
    LẦN 2 : CHĂN CẶP 92,93 K3N (TỪ 03/12 -> 05/12 ) NHẬN 93* NGÀY 1
    LẦN 3 : CHĂN CẶP 13,87 K3N (TỪ 04/12 -> 06/12 ) NHẬN 13* NGÀY 1
    LẦN 4 : CHĂN CẶP 78,87 K3N (TỪ 05/12 -> 07/12 ) NHẬN 78* 87* NG 1
    LẦN 5 : CHĂN CẶP 78,87 K3N (TỪ 06/12 -> 08/12 ) NHẬN 87* NGÀY 1
    LẦN 6 : CHĂN CẶP 77,93 K3N (TỪ 07/12 -> 09/12 ) NHẬN 77* NGÀY 2
    LẦN 7 : CHĂN CẶP 87,97 K3N (TỪ 09/12 -> 11/12 ) NHẬN 87* NGÀY 1
    LẦN 8 : CHĂN CẶP 78,87 K3N (TỪ 10/12 -> 12/12 ) NHẬN 87** NGÀY 1
    LẦN 9 : CHĂN CẶP 78,87 K3N (TỪ 11/12 -> 13/12 ) NHẬN 78** 87* N 1
    LẦN 10 : CHĂN CẶP 87,92 K3N (TỪ 12/12 -> 14/12 )
     
    ordy, Ssssss29, Lovely81 and 1 người khác Thích điều này.
  15. hoangmui

    hoangmui Lucky Xổ Số

    Tham gia:
    27/11/12
    Bài viết:
    6,090
    Được thích:
    6,698
    Điểm thành tích:
    113
    Nghề nghiệp:
    Giáo Sư Lô Đề
    CHĂN NUÔI LOTTO CẶP K3N THÁNG 12/2019
    Lần 1: chăn cặp 42,58 K3N (từ 01/12 ->03/12) miss
    Lần 2: chăn cặp 81,87 K3N (từ 04/12 ->06/12) nhận 87 ngày 2
    Lần 3: chăn cặp 78,93 K3N (từ 06/12 ->08/12) nhận 78 ngày 2
    Lần 4: chăn cặp 78,87 K3N (từ 08/12 ->10/12) nhận 78 ngày 1
    Lần 5: chăn cặp 42,78 K3N (từ 09/12 ->11/12) nhận 42*,78** ngày 3
    Lần 6: chăn cặp 78,87 K3N (từ 12/12 ->14/12)
     
    ordySsssss29 thích điều này.
  16. lotobe

    lotobe Thành viên kiểm duyệt

    Tham gia:
    11/3/17
    Bài viết:
    548
    Được thích:
    637
    Điểm thành tích:
    93
    CHĂN NUÔI K3N THÁNG 12/2019
    Lần 1: 080 (từ 01-03/12) Nhận 08, 80** Ngày 1
    Lần 2: 070 (từ 02-04/12) Nhận 07 Ngày 1
    Lần 3: 060 (từ 03-05/12) Nhận 06 ** Ngày 1
    Lần 4: 35,36 (từ 04-06/12) Nhận 35 Ngày 1
    Lần 5: 363 (từ 05-07/12) Nhận 36 Ngày 3
    Lần 6: 050 (từ 08-10/12) Nhận 50 Ngày 1
    Lần 7: 020 (từ 09-11/12) Nhận 20 Ngày 3

    Lần 8: 040 (từ 12-14/12) Nhận
     
    ntvanhp, ordy, consomayman86862 thành viên khác Thích điều này.
  17. bwin

    bwin Thành viên kiểm duyệt

    Tham gia:
    29/10/11
    Bài viết:
    207
    Được thích:
    878
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP THÁNG 12/2019 :
    LẦN 1: CHĂN CẶP 59,95 K3N(TỪ 01/12 -> 03/12).nhận 59 N1

    LẦN 2: CHĂN CẶP 95,96 K3N(TỪ 02/12 -> 04/12).nhận 96 N1

    LẦN 3: CHĂN CẶP 59,95 K3N(TỪ 03/12 -> 05/12).nhận 95 N1
    LẦN 4: CHĂN CẶP 58,85 K3N(TỪ 04/12 -> 06/12). Xịt
    LẦN 5: CHĂN CẶP 16,61 K3N(TỪ 07/12 -> 09/12) Nhận 16**,61 N1
    LẦN 6: CHĂN CẶP 34,43 K3N(TỪ 08/12 -> 10/12). Xịt
    Lần 7: Chăn cặp 78,88 K3N(từ 11/12 -> 12/12). Nhận 78**

    Lần 8: Chăn cặp 92,93 K3N(Từ 12/12 -> 14/12)
     
    ntvanhp, ordy, consomayman8686 and 1 người khác Thích điều này.
  18. Jimmy310

    Jimmy310 Thành viên kiểm duyệt

    Tham gia:
    3/10/11
    Bài viết:
    1,284
    Được thích:
    6,940
    Điểm thành tích:
    113
    Nghề nghiệp:
    Nghiên Cứu Lô Đề
    Chăn Stlo khung 3 ngày
    Lần 1 chăn Stlo 11,66 từ 2-4 nhận 11n2
    Lần 2 chăn Stlo 22,66 từ 4-6 nhận 66n3
    Lần 3 chăn Stlo 11,44 từ 7-9 nhận 44 n2
    Lần 4 chăn Stlo 99,88 từ 9-11 nhân 99** n3
    Lần 5 chăn 89,88 từ 12-14 nhận
     
    ordy, nghiatuyet, quangdai555 and 1 người khác Thích điều này.
  19. Lotto228

    Lotto228 Thành viên kiểm duyệt

    Tham gia:
    30/9/16
    Bài viết:
    666
    Được thích:
    977
    Điểm thành tích:
    93
    [​IMG]
    Lotto228Thành viên kiểm duyệt
    CHĂN NUÔI K3N THÁNG 12/2019:
    Lần 1: 808 từ 1–3. Nổ 808.80 ngày 1.
    Lần 2: 101 từ 2–4. Nổ 01 ngày 1.
    Lần 3: 585 từ 3–5.;a36
    Lần 4: 191 từ 6–8. Nổ 19 ngày 3.
    Lần 5: 575 từ 9–11. Nổ 57 ngày 1.

    Lần 6: 848 từ 10–12. Nổ 48 ngày 1.
    Lần 7: 070 từ 11–13. Nổ 07 ngày 1.
    Lần 8: 303 từ 12–14...
     
    choisogiaitriordy thích điều này.
  20. zjpzop

    zjpzop Lucky Xổ Số

    Tham gia:
    22/12/11
    Bài viết:
    454
    Được thích:
    1,944
    Điểm thành tích:
    93
    CHĂN NUÔI LOTTO CẶP K3N THÁNG 12/2019
    LẦN 1: CHĂN CẶP 95,59 K3N(TỪ 01/12-> 03/12) Nhận 59 ngày 1

    LẦN 2: CHĂN CẶP 11,66 K3N(TỪ 02/12-> 04/12) Nhận 11 ngày 2
    LẦN 3: CHĂN CẶP 15,51 K3N(TỪ 04/12-> 06/12) Nhận 51 ngày 1
    LẦN 3: CHĂN CẶP 03,30 K3N(TỪ 05/12-> 07/12) Nhận 30 ngày 1
    LẦN 4: CHĂN CẶP 67,76 K3N(TỪ 06/12-> 08/12) Nhận 76 ngày 1
    LẦN 5: CHĂN CẶP 68,86 K3N(TỪ 07/12-> 09/12) Nhận 68** ngày 1
    LẦN 6: CHĂN CẶP 39,93 K3N(TỪ 08/12-> 10/12) Nhận 39** ngày 1
    LẦN 7: CHĂN CẶP 08,80 K3N(TỪ 09/12-> 11/12) Nhận 08 ngày 1
    LẦN 8: CHĂN CẶP 07,17 K3N(TỪ 10/12-> 12/12) Nhận 07 ngày 2
    [B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B][B]LẦN 9: CHĂN CẶP 04,40 K3N(TỪ 12/12-> 14/12)[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
     
    vgdoanh82, ntvanhp, ordy3 thành viên khác Thích điều này.
Trạng thái chủ đề:
Tạm đóng.

Cộng đồng Ketqua.net