quảng cáo kqxs full

TOPIC CHĂN NUÔI K2N THÁNG 11/2018

Thảo luận trong 'KHU CHĂN NUÔI' bắt đầu bởi tiendhtb87, 31/10/18.

Lượt xem: 192,799

Tags:
  1. Maymanx10

    Maymanx10 Lính mới

    Tham gia:
    17/7/18
    Bài viết:
    44
    Được thích:
    76
    Xin chăn nuôi loto cặp K2N tháng 11/2018
    Lần 1: Chăn cặp 11.66( từ 6-7/11) Nhận 66 N1
    Lần 2: Chăn cặp 282(từ 7-8/11) Nhận xịt
    Lần 3: Chăn cặp 393( từ 9-10/11) Nhận...
     
  2. thiendangduy

    thiendangduy Lucky Xổ Số

    Tham gia:
    6/7/13
    Bài viết:
    555
    Được thích:
    1,071
    Nghề nghiệp:
    Design
    CHĂN NUÔI K2N THÁNG 11/2018

    Lần 1: 48 84 (01/11 -> 02/11) nhận 48* N2 ;qua
    Lần 2: 58 85 (03/11 -> 04/11) nhận xịt
    Lần 3: 58 85 (05/11 -> 06/11) nhận 58** N1 ;qua;qua
    Lần 4: 08 80 (06/11 -> 07/11) nhận xịt
    Lần 5: 08 80 (08/11 -> 09/11) nhận 80* N1 ;qua
    Lần 6: 13 31 (09/11 -> 10/11) nhận...

    A E Tham Khảo
    Chúc A E May Mắn.
     
    tiendhtb87 thích bài này.
  3. hoangtunglam

    hoangtunglam Chờ kích hoạt

    Tham gia:
    29/8/15
    Bài viết:
    74
    Được thích:
    69
    Lần 1: nuôi lô 38.83 từ 08-09/11
     
  4. sungato

    sungato Thành viên kiểm duyệt

    Tham gia:
    15/5/18
    Bài viết:
    140
    Được thích:
    412
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 11:
    + LẦN 1: CHĂN 14-41 (TỪ 2-3/11) NHẬN 14 ngày 02/11
    + LẦN 2: CHĂN 45-54 (TỪ 3-4/11) NHẬN sml
    + Lần 3: Chăn 59-95 (từ 5-6/11) NHẬN ...... Tiếp sml
    + Lần 4: chăn 58,78 (từ 7-8/11) nhận....78 ngày 08/11
    + Lần 5: chăn 62,42 (từ 9-10/11) nhận....
     
    tiendhtb87 thích bài này.
  5. datviet1na

    datviet1na Thành viên kiểm duyệt

    Tham gia:
    8/2/11
    Bài viết:
    785
    Được thích:
    464
    Nghề nghiệp:
    Bơ vơ
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 11/2018
    Lần 1: Chăn 38, 80 (từ 01-02/11).Nhận 80* N1
    Lần 2: Chăn 03, 30 (từ 02-03/11). Nhận 30* N2
    Lần 3: Chăn 03, 22 (từ 04-05/11). Miss
    Lần 4: Chăn 69, 96 (từ 06-07/11). Miss
    Lần 5: Chăn 12, 21 (từ 09-10/11).
     
    tiendhtb87 thích bài này.
  6. anhduc317

    anhduc317 Thành viên kiểm duyệt

    Tham gia:
    29/9/17
    Bài viết:
    772
    Được thích:
    805
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 11/2018
    Lần 1: Chăn 02,20 (từ 01-02/11)
    Lần 2: Chăn 02,20 (từ 03-04/11) nhận 02** N2
    Lần 3: Chăn 11,66 (từ 05-06/11) nhận 66*N2
    Lần 4: Chăn 03,30 (từ 07-08/11) nhận 03*.30* N1
    Lần 5: Chăn 01,10 (từ 08-09/11) nhận 01*N1
    Lần 6: Chăn 24,42 (từ 09-10/11)
     
  7. Halonglode

    Halonglode VIP Xổ Số

    Tham gia:
    20/7/18
    Bài viết:
    294
    Được thích:
    1,349
    Lần 1 chăn 11-66 từ 1-2/11 nhận ;a36
    Lần 2 chăn 383 từ 3-4/11 nhận 83n2
    Lần 3 chăn 050 từ 5-6/11 nhận 05 50 50 n1
    Lần 4 chăn 272 từ 6-7/11 nhận 27 27 n2
    Lần 5 chăn 33 99 từ 8-9/11 nhận 99n2
    Lần 6 chăn 151 từ 10-11/11 nhận ???
     
    tiendhtb87 thích bài này.
  8. canhdieumua93

    canhdieumua93 Lính mới

    Tham gia:
    7/11/18
    Bài viết:
    20
    Được thích:
    324
    Mới
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 11:
    + LẦN 1: CHĂN 86,94 (TỪ 07-08/11) NHẬN 94 ngày 2
    + LẦN 2: CHĂN
    00,70 (TỪ 09-10/11) NHẬN 70 ngày 1
    + LẦN 3: CHĂN
    00,50 (TỪ 10-11/11) Loading...
     
    linh2225, Mylo1911, Vinhbet4795 thành viên khác Thích điều này.
  9. thanhth1977

    thanhth1977 Thành viên kiểm duyệt

    Tham gia:
    8/4/11
    Bài viết:
    945
    Được thích:
    237
    Nghề nghiệp:
    Bụi đời chợ Đồng Xuân
    Lần 1: Chăn cặp 131 (từ 01-02/11) xịt chăn lại từ đầu
    Lần 2: Chăn cặp 141 (từ 03-04/11) Nhận 41* ngày 1 03/11
    Lần 3: Chăn cặp 030 (từ 04-05/11) xịt chăn lại từ đầu
    Lần 4: Chăn cặp 22,77 (từ 06-07/11) Nhận 22* ngày 1 06/11
    Lần 5: Chăn cặp 464 (từ 07-08/11) Nhận 46* ngày 1 07/11
    Lần 6: Chăn cặp 070 (từ 08-09/11) Nhận 70* ngày 2 09/11
    Lần 7: Chăn cặp 191 (từ 10-11/11)
     
    tiendhtb87 thích bài này.
  10. chuotnhatxo

    chuotnhatxo Thành viên kiểm duyệt

    Tham gia:
    5/4/18
    Bài viết:
    372
    Được thích:
    438
    Chăn nuôi STL K2N tháng 11/2018
    Lần 1: Chăn cặp 03,30 từ 1-2/11 xit
    Lần 2: Chăn cặp 03,30 từ 3-4/11 nhận 30 N1
    Ngay 4/11 nghi om
    Lần 3: Chăn cặp 02,20 từ 5-6/11 nhận 02 N2
    Lần 4: Chăn cặp 01,10 từ 7-8/11 nhận 01 N2
    Lần 5: Chăn cặp 09,90 từ 9-10/11 nhận 09,90 N1
    Lần 6: Chăn cặp 00,88 từ 10-11/11 nhận …
     
    tiendhtb87 thích bài này.
  11. TomVip

    TomVip Thành viên kiểm duyệt

    Tham gia:
    20/11/17
    Bài viết:
    430
    Được thích:
    536
    *** CHĂN NUÔI LOTTO CẶP K2N THÁNG 11/2018 ****
    +LẦN 1: CHĂN CẶP 13-31 K2N(TỪ 01->02) MISS
    +LẦN 2: CHĂN CẶP 57-02 K2N(TỪ 03->04) NHẬN 57* N1
    +LẦN 3: CHĂN CẶP 02-96 K2N(TỪ 04->05) NHẬN 02** N1
    +LẦN 4: CHĂN CẶP 22.96 K2N(TỪ 05->06) NHẬN 22* N2
    + NGÀY 07: NGHỈ
    +LẦN 5: CHĂN CẶP 69.96 K2N(TỪ 08->09) NHẬN 69** N1
    +LẦN 6: CHĂN CẶP 91.96 K2N(TỪ 09->10) NHẬN 91* N1
    +LẦN 7: CHĂN CẶP 91.31 K2N(TỪ 10->11) NHẬN..........(CHĂN 96 HÔM CUỐI)
     
    tiendhtb87 thích bài này.
  12. fantosy

    fantosy Thành viên kiểm duyệt

    Tham gia:
    14/2/13
    Bài viết:
    170
    Được thích:
    25
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 11:
    + LẦN 1: CHĂN 87-78 (TỪ 3 - 4/11) NHẬN......87-87 N1
    + Lần 2: chăn 97-79(Từ 4 - 5/11)
    NHẬN .... 79 N2
    + Lần 3: chăn 13-27 (từ 6-7/11)
    NHẬN...... 27-27 N2
    + Lần 4: chăn 41 - 71 (tử 8-9/11)
    NHẬN.... 41 N1
    + Lần 5: chăn 12 - 65 ( từ 9-10/11)
    NHẬN ..... 12 N1
    + Lần 6: chăn 23 - 49 ( từ 10-11/11)
    NHẬN......
     
    tiendhtb87 thích bài này.
  13. Maymanx10

    Maymanx10 Lính mới

    Tham gia:
    17/7/18
    Bài viết:
    44
    Được thích:
    76
    Xin chăn nuôi loto cặp K2N tháng 11/2018
    Lần 1: Chăn cặp 11.66( từ 6-7/11) Nhận 66 N1
    Lần 2: Chăn cặp 282(từ 7-8/11) Nhận xịt
    Lần 3: Chăn cặp 393( từ 9-10/11) Nhận 39 N1
    Lần 4: Chăn cặp 787 (từ 10-11/11) Nhận...
     
    tiendhtb87 thích bài này.
  14. cuonglo0092

    cuonglo0092 Thành viên kiểm duyệt

    Tham gia:
    13/3/18
    Bài viết:
    96
    Được thích:
    123
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 11/2018
    Lần 1: Chăn 00,05 (từ 01-02/11) nhận 00 N1
    Lần 2 : chăn 00,05 ( từ 02-03/11) nhận 00 N2

    Lần 3 : chăn 00,05 ( từ 04-05/11) nhận 05 N1
    Lần 4 : chăn 00,05 ( từ 05-06/11) nhận 00.05 N1
    Lần 5 : chăn 00,05 ( từ 06-07/11) nhận 00 N2
    Lần 6: Chăn 00,05 ( từ 08-09/11) nhận.. gãy tv
    [B][B][B][B][B][B][B][B][B][B][B][B]Lần 7: Chăn 58,60 ( từ 10-11/11) nhận..[/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B][/B]
     
    thichthanhdong, amphonglaoquaitiendhtb87 Thích điều này.
  15. hlinh1211

    hlinh1211 Thành viên kiểm duyệt

    Tham gia:
    15/7/18
    Bài viết:
    207
    Được thích:
    486
    Chăn nuôi lô tô tháng 11/2018
    Lần 1:606(2_3)nhận......06N2
    Lần 2:494(4_5)nhận......94N1
    Lần 3:585(5_6)nhận...58**N1
    Lần 4:92,99(6_7)nhận.Xịt
    Lần 5:92 99(8_9)nhận...99N2
     
    tiendhtb87 thích bài này.
  16. hlinh1211

    hlinh1211 Thành viên kiểm duyệt

    Tham gia:
    15/7/18
    Bài viết:
    207
    Được thích:
    486
    Chăn nuôi lô tô tháng 11/2018
    Lần 1:606(2_3)nhận......06N2
    Lần 2:494(4_5)nhận......94N1
    Lần 3:585(5_6)nhận...58**N1
    Lần 4:92,99(6_7)nhận.Xịt
    Lần 5:92 99(8_9)nhận...99N2
    Lần 6:494(10_11)nhận
     
    tiendhtb87 thích bài này.
  17. zozin

    zozin Thành viên kiểm duyệt

    Tham gia:
    17/6/18
    Bài viết:
    185
    Được thích:
    871
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 11:
    + LẦN 1: CHĂN 80-90 (TỪ 1-2/11) NHẬN 80 N1
    + Lần 2: chăn :26-62 ( từ 2-3/11) nhận 62 N2
    + Lần 3: chăn 02-20 ( từ 4-5/11) nhận 02,02 N1
    + Lần 4: chăn 14-41 ( từ 5-6/11) nhận 14 N2
    + Lần 5: chăn 70-80 ( từ 7-8/11) nhận 70 N1
    + Lần 6: chăn 75-57 ( từ 8-9/11) nhận xịt
    + Lần 7: chăn 89-98 ( từ 10-11/11) nhận
     
    Chỉnh sửa cuối: 10/11/18 lúc 21:30
    tiendhtb87 thích bài này.
  18. nenh01

    nenh01 Chờ kích hoạt

    Tham gia:
    26/7/14
    Bài viết:
    63
    Được thích:
    149
    Chăn nuôi Loto K2N tháng 11
    Lần 1 : chăn cặp 25,52 (01-02) nhận 25 N1
    Lần 2 : chăn cặp 46,64 (02-03) nhận 64 N1
    Lần 3 : chăn cặp 58,85 (03-04) nhận xịt
    Lần 4 : chăn cặp 24,42 (05-06) nhận 24 N1
    Lần 5 : chăn cặp 24,42 (06-07) nhận xit lan2
    Ngày 08 nghỉ
    Lần 6 : chăn cặp 92,91 (09-10) nhận 91 N2
    Lần 7 : chăn cặp 92,93 (10-11) nhận ...?
     
    tiendhtb87, LaGiang1987Le nguyen ngochan Thích điều này.
  19. DinhNam374

    DinhNam374 Chờ kích hoạt

    Tham gia:
    28/10/17
    Bài viết:
    142
    Được thích:
    524
    Chăn nuôi cặp loto K2N:
    Lần 1: chăn cặp 36-63 K2N (từ 01/11 -> 02/11) nhận 63n1

    Lần 2: chăn cặp 35-53 K2N (từ 02/11 -> 03/11) nhận Tạch
    Lần 3 : chăn cặp 89-98 K2N ( từ 04/11->05/11) nhận 89n2
    Lần 4 : chăn cặp 22-77 K2N ( từ 06/11->07/11) nhận 22 n1
    Lần 5 : chăn cặp 45-54 K2N ( từ 07/11 -> 08/11) nhận 54 n1
    Lần 6 : chăn cặp 44-99 K2N ( từ 08/11 -> 09/11) nhận 99 n2
    Lần 7 : chăn cặp 83-38 K2N ( từ 10/11 -> 11/11) nhận
     
    tiendhtb87 thích bài này.
  20. lotoru

    lotoru Thành viên kiểm duyệt

    Tham gia:
    14/9/14
    Bài viết:
    1,522
    Được thích:
    404
    Nghề nghiệp:
    co bac chuyen nghiep
    CHĂN NUÔI LOTTO CẶP K2N THÁNG 11
    Lần 1: 04,40 (01-02/11) nhận 04 n1
    Lần 2: 14,41 (02-03/11) nhan 14 n1
    Lan 3: 59,95 (03-04/11) nhân 59 n1
    Lần 4: 04,40 (04-05/11) nhan 40 n1
    Lần 5: 58,85 (05-06/11) nhan 58 n1
    Lần 6: 37,73 (06-07/11) nhan 73 n1
    Lần 7: 31,13 (07-08/11) nhan 31 n1
    Lần 8: 48,84 (08-09/11) nhan 48 n2
    Lần 9: 88,33 (10-11/11)
     
    tiendhtb87, mangtay, phanthuy7766 thành viên khác Thích điều này.

Cộng đồng Ketqua.net